C23H18F2IN3OS — CID 3950696
2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide (PubChem CID 3950696) has the molecular formula C23H18F2IN3OS and a molecular weight of 549.38 g/mol. Its IUPAC name is 2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3950696 |
| Molecular Formula | C23H18F2IN3OS |
| Molecular Weight | 549.38 g/mol |
| Exact Mass | 549.02 |
| IUPAC Name | 2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)Nc2ccc(SC(F)F)cc2)c(C)n1-c1ccc(I)cc1 |
| InChI | InChI=1S/C23H18F2IN3OS/c1-14-11-16(15(2)29(14)20-7-3-18(26)4-8-20)12-17(13-27)22(30)28-19-5-9-21(10-6-19)31-23(24)25/h3-12,23H,1-2H3,(H,28,30) |
| InChIKey | RWGXEFWAZGDDLS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.38 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|