C27H26FN3O2 — CID 4292597
2-cyano-3-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]-N-(2-methylcyclohexyl)prop-2-enamide (PubChem CID 4292597) has the molecular formula C27H26FN3O2 and a molecular weight of 443.52 g/mol. Its IUPAC name is 2-cyano-3-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]-N-(2-methylcyclohexyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]-N-(2-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 4292597 |
| Molecular Formula | C27H26FN3O2 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-cyano-3-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]-N-(2-methylcyclohexyl)prop-2-enamide |
| SMILES | Cc1c(C=C(C#N)C(=O)NC2CCCCC2C)c2ccccn2c1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H26FN3O2/c1-17-7-3-4-8-23(17)30-27(33)20(16-29)15-22-18(2)25(31-14-6-5-9-24(22)31)26(32)19-10-12-21(28)13-11-19/h5-6,9-15,17,23H,3-4,7-8H2,1-2H3,(H,30,33) |
| InChIKey | KUGSUHORRSNICK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 74.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|