C27H28FN3O — CID 6104029
(E)-2-cyano-3-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]-N-(2-methylcyclohexyl)prop-2-enamide (PubChem CID 6104029) has the molecular formula C27H28FN3O and a molecular weight of 429.54 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]-N-(2-methylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]-N-(2-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 6104029 |
| Molecular Formula | C27H28FN3O |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (E)-2-cyano-3-[1-[(4-fluorophenyl)methyl]-2-methylindol-3-yl]-N-(2-methylcyclohexyl)prop-2-enamide |
| SMILES | Cc1c(/C=C(\C#N)C(=O)NC2CCCCC2C)c2ccccc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FN3O/c1-18-7-3-5-9-25(18)30-27(32)21(16-29)15-24-19(2)31(26-10-6-4-8-23(24)26)17-20-11-13-22(28)14-12-20/h4,6,8,10-15,18,25H,3,5,7,9,17H2,1-2H3,(H,30,32)/b21-15+ |
| InChIKey | XFWIZCMJYQWPOW-RCCKNPSSSA-N |
| XLogP | 5.74 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|