C25H24N2O — CID 7275650
(E)-3-anthracen-9-yl-2-cyano-N-[(1R,2R)-2-methylcyclohexyl]prop-2-enamide (PubChem CID 7275650) has the molecular formula C25H24N2O and a molecular weight of 368.48 g/mol. Its IUPAC name is (E)-3-anthracen-9-yl-2-cyano-N-[(1R,2R)-2-methylcyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-anthracen-9-yl-2-cyano-N-[(1R,2R)-2-methylcyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 7275650 |
| Molecular Formula | C25H24N2O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (E)-3-anthracen-9-yl-2-cyano-N-[(1R,2R)-2-methylcyclohexyl]prop-2-enamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)/C(C#N)=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C25H24N2O/c1-17-8-2-7-13-24(17)27-25(28)20(16-26)15-23-21-11-5-3-9-18(21)14-19-10-4-6-12-22(19)23/h3-6,9-12,14-15,17,24H,2,7-8,13H2,1H3,(H,27,28)/b20-15+/t17-,24-/m1/s1 |
| InChIKey | CJRGIIWBXSTQDW-VWYATJCMSA-N |
| XLogP | 5.59 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|