C19H20N4O — CID 9353235
(E)-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]-3-quinoxalin-2-ylprop-2-enamide (PubChem CID 9353235) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is (E)-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]-3-quinoxalin-2-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]-3-quinoxalin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 9353235 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (E)-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]-3-quinoxalin-2-ylprop-2-enamide |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)/C(C#N)=C/c1cnc2ccccc2n1 |
| InChI | InChI=1S/C19H20N4O/c1-13-6-2-3-7-16(13)23-19(24)14(11-20)10-15-12-21-17-8-4-5-9-18(17)22-15/h4-5,8-10,12-13,16H,2-3,6-7H2,1H3,(H,23,24)/b14-10+/t13-,16-/m0/s1 |
| InChIKey | HCOMGFCMWISEEA-HCJRSGCNSA-N |
| XLogP | 3.23 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|