C19H23ClFN5S — CID 3970905
1-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-cyclohexylthiourea (PubChem CID 3970905) has the molecular formula C19H23ClFN5S and a molecular weight of 407.95 g/mol. Its IUPAC name is 1-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-cyclohexylthiourea.
| Compound Name | 1-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 3970905 |
| Molecular Formula | C19H23ClFN5S |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-cyclohexylthiourea |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(Cl)c1C=NNC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C19H23ClFN5S/c1-13-17(11-22-24-19(27)23-16-5-3-2-4-6-16)18(20)26(25-13)12-14-7-9-15(21)10-8-14/h7-11,16H,2-6,12H2,1H3,(H2,23,24,27) |
| InChIKey | IEKJGYHDJMGJPB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|