C17H21ClFN5S — CID 4013966
1-butyl-3-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]thiourea (PubChem CID 4013966) has the molecular formula C17H21ClFN5S and a molecular weight of 381.91 g/mol. Its IUPAC name is 1-butyl-3-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]thiourea.
| Compound Name | 1-butyl-3-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 4013966 |
| Molecular Formula | C17H21ClFN5S |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-butyl-3-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]thiourea |
| SMILES | CCCCNC(=S)NN=Cc1c(C)nn(Cc2ccc(F)cc2)c1Cl |
| InChI | InChI=1S/C17H21ClFN5S/c1-3-4-9-20-17(25)22-21-10-15-12(2)23-24(16(15)18)11-13-5-7-14(19)8-6-13/h5-8,10H,3-4,9,11H2,1-2H3,(H2,20,22,25) |
| InChIKey | NNJYDCRIWBDUKF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|