C14H13ClFN5O2 — CID 2635604
N'-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]oxamide (PubChem CID 2635604) has the molecular formula C14H13ClFN5O2 and a molecular weight of 337.74 g/mol. Its IUPAC name is N'-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]oxamide.
| Compound Name | N'-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 2635604 |
| Molecular Formula | C14H13ClFN5O2 |
| Molecular Weight | 337.74 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N'-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]oxamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(Cl)c1C=NNC(=O)C(N)=O |
| InChI | InChI=1S/C14H13ClFN5O2/c1-8-11(6-18-19-14(23)13(17)22)12(15)21(20-8)7-9-2-4-10(16)5-3-9/h2-6H,7H2,1H3,(H2,17,22)(H,19,23) |
| InChIKey | XNRRPOADHYIWLD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.74 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|