C13H12Cl3N5O — CID 2690830
[[5-chloro-1-[(2,6-dichlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]urea (PubChem CID 2690830) has the molecular formula C13H12Cl3N5O and a molecular weight of 360.63 g/mol. Its IUPAC name is [[5-chloro-1-[(2,6-dichlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]urea.
| Compound Name | [[5-chloro-1-[(2,6-dichlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 2690830 |
| Molecular Formula | C13H12Cl3N5O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | [[5-chloro-1-[(2,6-dichlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]urea |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c(Cl)c1C=NNC(N)=O |
| InChI | InChI=1S/C13H12Cl3N5O/c1-7-8(5-18-19-13(17)22)12(16)21(20-7)6-9-10(14)3-2-4-11(9)15/h2-5H,6H2,1H3,(H3,17,19,22) |
| InChIKey | DDZCMTOTDFJNOT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|