C21H20ClN5O2 — CID 9179636
N'-[(Z)-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-N-(4-methylphenyl)oxamide (PubChem CID 9179636) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is N'-[(Z)-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[(Z)-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 9179636 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N'-[(Z)-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-N-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N/N=C\c2c(C)nn(Cc3ccccc3)c2Cl)cc1 |
| InChI | InChI=1S/C21H20ClN5O2/c1-14-8-10-17(11-9-14)24-20(28)21(29)25-23-12-18-15(2)26-27(19(18)22)13-16-6-4-3-5-7-16/h3-12H,13H2,1-2H3,(H,24,28)(H,25,29)/b23-12- |
| InChIKey | OLXXQUPZSGYPPJ-FMCGGJTJSA-N |
| XLogP | 3.29 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|