C28H28ClN5O3S — CID 6905700
N-[(E)-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-4-[[methyl-(4-methylphenyl)sulfonylamino]methyl]benzamide (PubChem CID 6905700) has the molecular formula C28H28ClN5O3S and a molecular weight of 550.08 g/mol. Its IUPAC name is N-[(E)-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-4-[[methyl-(4-methylphenyl)sulfonylamino]methyl]benzamide.
| Compound Name | N-[(E)-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-4-[[methyl-(4-methylphenyl)sulfonylamino]methyl]benzamide |
|---|---|
| PubChem CID | 6905700 |
| Molecular Formula | C28H28ClN5O3S |
| Molecular Weight | 550.08 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | N-[(E)-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-4-[[methyl-(4-methylphenyl)sulfonylamino]methyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)Cc2ccc(C(=O)N/N=C/c3c(C)nn(Cc4ccccc4)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H28ClN5O3S/c1-20-9-15-25(16-10-20)38(36,37)33(3)18-23-11-13-24(14-12-23)28(35)31-30-17-26-21(2)32-34(27(26)29)19-22-7-5-4-6-8-22/h4-17H,18-19H2,1-3H3,(H,31,35)/b30-17+ |
| InChIKey | SCBADDHLNAQTBE-OCSSWDANSA-N |
| XLogP | 4.79 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.08 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|