C22H22N4O3S — CID 3947692
4-[[methyl-(4-methylphenyl)sulfonylamino]methyl]-N-(pyridin-2-ylmethylideneamino)benzamide (PubChem CID 3947692) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-[[methyl-(4-methylphenyl)sulfonylamino]methyl]-N-(pyridin-2-ylmethylideneamino)benzamide.
| Compound Name | 4-[[methyl-(4-methylphenyl)sulfonylamino]methyl]-N-(pyridin-2-ylmethylideneamino)benzamide |
|---|---|
| PubChem CID | 3947692 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-[[methyl-(4-methylphenyl)sulfonylamino]methyl]-N-(pyridin-2-ylmethylideneamino)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)Cc2ccc(C(=O)NN=Cc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c1-17-6-12-21(13-7-17)30(28,29)26(2)16-18-8-10-19(11-9-18)22(27)25-24-15-20-5-3-4-14-23-20/h3-15H,16H2,1-2H3,(H,25,27) |
| InChIKey | WRZLANHQAMFOOY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|