C26H22N4O3S — CID 4658290
4-[[N-(benzenesulfonyl)anilino]methyl]-N-(pyridin-2-ylmethylideneamino)benzamide (PubChem CID 4658290) has the molecular formula C26H22N4O3S and a molecular weight of 470.55 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(pyridin-2-ylmethylideneamino)benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(pyridin-2-ylmethylideneamino)benzamide |
|---|---|
| PubChem CID | 4658290 |
| Molecular Formula | C26H22N4O3S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(pyridin-2-ylmethylideneamino)benzamide |
| SMILES | O=C(NN=Cc1ccccn1)c1ccc(CN(c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N4O3S/c31-26(29-28-19-23-9-7-8-18-27-23)22-16-14-21(15-17-22)20-30(24-10-3-1-4-11-24)34(32,33)25-12-5-2-6-13-25/h1-19H,20H2,(H,29,31) |
| InChIKey | WAEZIVRCMZRYGW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|