C26H20F2N2O3S — CID 1297380
4-[[N-(benzenesulfonyl)anilino]methyl]-N-(3,4-difluorophenyl)benzamide (PubChem CID 1297380) has the molecular formula C26H20F2N2O3S and a molecular weight of 478.52 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(3,4-difluorophenyl)benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(3,4-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 1297380 |
| Molecular Formula | C26H20F2N2O3S |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(3,4-difluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(CN(c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H20F2N2O3S/c27-24-16-15-21(17-25(24)28)29-26(31)20-13-11-19(12-14-20)18-30(22-7-3-1-4-8-22)34(32,33)23-9-5-2-6-10-23/h1-17H,18H2,(H,29,31) |
| InChIKey | FKBPJIRADGQSMO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |