C32H25ClN2O4S — CID 21372436
4-[[N-(benzenesulfonyl)anilino]methyl]-N-(5-chloro-2-phenoxyphenyl)benzamide (PubChem CID 21372436) has the molecular formula C32H25ClN2O4S and a molecular weight of 569.08 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(5-chloro-2-phenoxyphenyl)benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(5-chloro-2-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 21372436 |
| Molecular Formula | C32H25ClN2O4S |
| Molecular Weight | 569.08 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(5-chloro-2-phenoxyphenyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Oc1ccccc1)c1ccc(CN(c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H25ClN2O4S/c33-26-20-21-31(39-28-12-6-2-7-13-28)30(22-26)34-32(36)25-18-16-24(17-19-25)23-35(27-10-4-1-5-11-27)40(37,38)29-14-8-3-9-15-29/h1-22H,23H2,(H,34,36) |
| InChIKey | RQFHRTCNIKMIGP-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.08 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |