C32H26N2O3S2 — CID 126271468
4-[[N-(benzenesulfonyl)anilino]methyl]-N-(2-phenylsulfanylphenyl)benzamide (PubChem CID 126271468) has the molecular formula C32H26N2O3S2 and a molecular weight of 550.71 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(2-phenylsulfanylphenyl)benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(2-phenylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 126271468 |
| Molecular Formula | C32H26N2O3S2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-(2-phenylsulfanylphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1Sc1ccccc1)c1ccc(CN(c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H26N2O3S2/c35-32(33-30-18-10-11-19-31(30)38-28-14-6-2-7-15-28)26-22-20-25(21-23-26)24-34(27-12-4-1-5-13-27)39(36,37)29-16-8-3-9-17-29/h1-23H,24H2,(H,33,35) |
| InChIKey | RYXHZGRWETVMPI-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |