C27H24N2O3S2 — CID 1298465
2-[benzyl(methylsulfonyl)amino]-N-(2-phenylsulfanylphenyl)benzamide (PubChem CID 1298465) has the molecular formula C27H24N2O3S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 2-[benzyl(methylsulfonyl)amino]-N-(2-phenylsulfanylphenyl)benzamide.
| Compound Name | 2-[benzyl(methylsulfonyl)amino]-N-(2-phenylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 1298465 |
| Molecular Formula | C27H24N2O3S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 2-[benzyl(methylsulfonyl)amino]-N-(2-phenylsulfanylphenyl)benzamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1)c1ccccc1C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C27H24N2O3S2/c1-34(31,32)29(20-21-12-4-2-5-13-21)25-18-10-8-16-23(25)27(30)28-24-17-9-11-19-26(24)33-22-14-6-3-7-15-22/h2-19H,20H2,1H3,(H,28,30) |
| InChIKey | GNNNPABKLJKUMX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |