C29H26N2O5S — CID 1365080
ethyl 2-[[2-[benzenesulfonyl(benzyl)amino]benzoyl]amino]benzoate (PubChem CID 1365080) has the molecular formula C29H26N2O5S and a molecular weight of 514.60 g/mol. Its IUPAC name is ethyl 2-[[2-[benzenesulfonyl(benzyl)amino]benzoyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[benzenesulfonyl(benzyl)amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 1365080 |
| Molecular Formula | C29H26N2O5S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | ethyl 2-[[2-[benzenesulfonyl(benzyl)amino]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1ccccc1N(Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H26N2O5S/c1-2-36-29(33)24-17-9-11-19-26(24)30-28(32)25-18-10-12-20-27(25)31(21-22-13-5-3-6-14-22)37(34,35)23-15-7-4-8-16-23/h3-20H,2,21H2,1H3,(H,30,32) |
| InChIKey | HVUIALIELLXSPD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |