C36H33N3O4S — CID 126116430
2-[[2-[benzyl-(4-methylphenyl)sulfonylamino]benzoyl]amino]-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 126116430) has the molecular formula C36H33N3O4S and a molecular weight of 603.74 g/mol. Its IUPAC name is 2-[[2-[benzyl-(4-methylphenyl)sulfonylamino]benzoyl]amino]-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 2-[[2-[benzyl-(4-methylphenyl)sulfonylamino]benzoyl]amino]-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 126116430 |
| Molecular Formula | C36H33N3O4S |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | 2-[[2-[benzyl-(4-methylphenyl)sulfonylamino]benzoyl]amino]-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2C(=O)Nc2ccccc2C(=O)N[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H33N3O4S/c1-26-21-23-30(24-22-26)44(42,43)39(25-28-13-5-3-6-14-28)34-20-12-10-18-32(34)36(41)38-33-19-11-9-17-31(33)35(40)37-27(2)29-15-7-4-8-16-29/h3-24,27H,25H2,1-2H3,(H,37,40)(H,38,41)/t27-/m1/s1 |
| InChIKey | RKJGIAJMZAXXAU-HHHXNRCGSA-N |
| XLogP | 7.13 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |