C35H32N2O3S — CID 99644759
2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[(S)-(2-methylphenyl)-phenylmethyl]benzamide (PubChem CID 99644759) has the molecular formula C35H32N2O3S and a molecular weight of 560.72 g/mol. Its IUPAC name is 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[(S)-(2-methylphenyl)-phenylmethyl]benzamide.
| Compound Name | 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[(S)-(2-methylphenyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 99644759 |
| Molecular Formula | C35H32N2O3S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-[(S)-(2-methylphenyl)-phenylmethyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2C(=O)N[C@@H](c2ccccc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C35H32N2O3S/c1-26-21-23-30(24-22-26)41(39,40)37(25-28-14-5-3-6-15-28)33-20-12-11-19-32(33)35(38)36-34(29-16-7-4-8-17-29)31-18-10-9-13-27(31)2/h3-24,34H,25H2,1-2H3,(H,36,38)/t34-/m0/s1 |
| InChIKey | YFFOPENXKXNOFO-UMSFTDKQSA-N |
| XLogP | 7.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |