C30H30N2O3S — CID 100632108
2-[benzenesulfonyl(benzyl)amino]-N-[(1R)-1-(4-ethylphenyl)ethyl]benzamide (PubChem CID 100632108) has the molecular formula C30H30N2O3S and a molecular weight of 498.65 g/mol. Its IUPAC name is 2-[benzenesulfonyl(benzyl)amino]-N-[(1R)-1-(4-ethylphenyl)ethyl]benzamide.
| Compound Name | 2-[benzenesulfonyl(benzyl)amino]-N-[(1R)-1-(4-ethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 100632108 |
| Molecular Formula | C30H30N2O3S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 2-[benzenesulfonyl(benzyl)amino]-N-[(1R)-1-(4-ethylphenyl)ethyl]benzamide |
| SMILES | CCc1ccc([C@@H](C)NC(=O)c2ccccc2N(Cc2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N2O3S/c1-3-24-18-20-26(21-19-24)23(2)31-30(33)28-16-10-11-17-29(28)32(22-25-12-6-4-7-13-25)36(34,35)27-14-8-5-9-15-27/h4-21,23H,3,22H2,1-2H3,(H,31,33)/t23-/m1/s1 |
| InChIKey | TZLOVUUOBZHBME-HSZRJFAPSA-N |
| XLogP | 6.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |