C29H27N3O4S — CID 2207753
2-[[2-[benzenesulfonyl(methyl)amino]benzoyl]amino]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 2207753) has the molecular formula C29H27N3O4S and a molecular weight of 513.62 g/mol. Its IUPAC name is 2-[[2-[benzenesulfonyl(methyl)amino]benzoyl]amino]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2-[[2-[benzenesulfonyl(methyl)amino]benzoyl]amino]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 2207753 |
| Molecular Formula | C29H27N3O4S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-[[2-[benzenesulfonyl(methyl)amino]benzoyl]amino]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1NC(=O)c1ccccc1N(C)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27N3O4S/c1-21(22-13-5-3-6-14-22)30-28(33)24-17-9-11-19-26(24)31-29(34)25-18-10-12-20-27(25)32(2)37(35,36)23-15-7-4-8-16-23/h3-21H,1-2H3,(H,30,33)(H,31,34)/t21-/m0/s1 |
| InChIKey | UBTLSLHYCPUHIF-NRFANRHFSA-N |
| XLogP | 5.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |