C22H19BrN2O2 — CID 4935078
2-[(2-bromobenzoyl)amino]-N-(1-phenylethyl)benzamide (PubChem CID 4935078) has the molecular formula C22H19BrN2O2 and a molecular weight of 423.31 g/mol. Its IUPAC name is 2-[(2-bromobenzoyl)amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 2-[(2-bromobenzoyl)amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4935078 |
| Molecular Formula | C22H19BrN2O2 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 2-[(2-bromobenzoyl)amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccccc1NC(=O)c1ccccc1Br)c1ccccc1 |
| InChI | InChI=1S/C22H19BrN2O2/c1-15(16-9-3-2-4-10-16)24-22(27)18-12-6-8-14-20(18)25-21(26)17-11-5-7-13-19(17)23/h2-15H,1H3,(H,24,27)(H,25,26) |
| InChIKey | ROHMVQNEESSHBG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |