C23H21BrN2O2 — CID 4935158
3-bromo-4-methyl-N-[2-(1-phenylethylcarbamoyl)phenyl]benzamide (PubChem CID 4935158) has the molecular formula C23H21BrN2O2 and a molecular weight of 437.34 g/mol. Its IUPAC name is 3-bromo-4-methyl-N-[2-(1-phenylethylcarbamoyl)phenyl]benzamide.
| Compound Name | 3-bromo-4-methyl-N-[2-(1-phenylethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 4935158 |
| Molecular Formula | C23H21BrN2O2 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 3-bromo-4-methyl-N-[2-(1-phenylethylcarbamoyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2C(=O)NC(C)c2ccccc2)cc1Br |
| InChI | InChI=1S/C23H21BrN2O2/c1-15-12-13-18(14-20(15)24)22(27)26-21-11-7-6-10-19(21)23(28)25-16(2)17-8-4-3-5-9-17/h3-14,16H,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | WPORRCXXKXWBCM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |