C48H46N4O4 — CID 570721
2-[2,6-bis(1-phenylethylcarbamoyl)phenyl]-1-N,3-N-bis(1-phenylethyl)benzene-1,3-dicarboxamide (PubChem CID 570721) has the molecular formula C48H46N4O4 and a molecular weight of 742.92 g/mol. Its IUPAC name is 2-[2,6-bis(1-phenylethylcarbamoyl)phenyl]-1-N,3-N-bis(1-phenylethyl)benzene-1,3-dicarboxamide.
| Compound Name | 2-[2,6-bis(1-phenylethylcarbamoyl)phenyl]-1-N,3-N-bis(1-phenylethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 570721 |
| Molecular Formula | C48H46N4O4 |
| Molecular Weight | 742.92 g/mol |
| Exact Mass | 742.35 |
| IUPAC Name | 2-[2,6-bis(1-phenylethylcarbamoyl)phenyl]-1-N,3-N-bis(1-phenylethyl)benzene-1,3-dicarboxamide |
| SMILES | CC(NC(=O)c1cccc(C(=O)NC(C)c2ccccc2)c1-c1c(C(=O)NC(C)c2ccccc2)cccc1C(=O)NC(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H46N4O4/c1-31(35-19-9-5-10-20-35)49-45(53)39-27-17-28-40(46(54)50-32(2)36-21-11-6-12-22-36)43(39)44-41(47(55)51-33(3)37-23-13-7-14-24-37)29-18-30-42(44)48(56)52-34(4)38-25-15-8-16-26-38/h5-34H,1-4H3,(H,49,53)(H,50,54)(H,51,55)(H,52,56) |
| InChIKey | FHNQXOBFIZTUQX-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.92 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |