C30H28N2O2Se2 — CID 10531743
N-[(1S)-1-phenylethyl]-2-[[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]diselanyl]benzamide (PubChem CID 10531743) has the molecular formula C30H28N2O2Se2 and a molecular weight of 606.49 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]-2-[[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]diselanyl]benzamide.
| Compound Name | N-[(1S)-1-phenylethyl]-2-[[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]diselanyl]benzamide |
|---|---|
| PubChem CID | 10531743 |
| Molecular Formula | C30H28N2O2Se2 |
| Molecular Weight | 606.49 g/mol |
| Exact Mass | 608.05 |
| IUPAC Name | N-[(1S)-1-phenylethyl]-2-[[2-[[(1S)-1-phenylethyl]carbamoyl]phenyl]diselanyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1[Se][Se]c1ccccc1C(=O)N[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28N2O2Se2/c1-21(23-13-5-3-6-14-23)31-29(33)25-17-9-11-19-27(25)35-36-28-20-12-10-18-26(28)30(34)32-22(2)24-15-7-4-8-16-24/h3-22H,1-2H3,(H,31,33)(H,32,34)/t21-,22-/m0/s1 |
| InChIKey | WONOGQIZNYFIQN-VXKWHMMOSA-N |
| XLogP | 3.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|