C16H14NO3- — CID 6929624
2-[[(1S)-1-phenylethyl]carbamoyl]benzoate (PubChem CID 6929624) has the molecular formula C16H14NO3- and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-[[(1S)-1-phenylethyl]carbamoyl]benzoate.
| Compound Name | 2-[[(1S)-1-phenylethyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 6929624 |
| Molecular Formula | C16H14NO3- |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-[[(1S)-1-phenylethyl]carbamoyl]benzoate |
| SMILES | C[C@H](NC(=O)c1ccccc1C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H15NO3/c1-11(12-7-3-2-4-8-12)17-15(18)13-9-5-6-10-14(13)16(19)20/h2-11H,1H3,(H,17,18)(H,19,20)/p-1/t11-/m0/s1 |
| InChIKey | VCFKXWGKKDZMPO-NSHDSACASA-M |
| XLogP | 1.54 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |