C27H24N2O3S — CID 1097903
2-[benzenesulfonyl(benzyl)amino]-N-(2-methylphenyl)benzamide (PubChem CID 1097903) has the molecular formula C27H24N2O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is 2-[benzenesulfonyl(benzyl)amino]-N-(2-methylphenyl)benzamide.
| Compound Name | 2-[benzenesulfonyl(benzyl)amino]-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 1097903 |
| Molecular Formula | C27H24N2O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-[benzenesulfonyl(benzyl)amino]-N-(2-methylphenyl)benzamide |
| SMILES | Cc1ccccc1NC(=O)c1ccccc1N(Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24N2O3S/c1-21-12-8-10-18-25(21)28-27(30)24-17-9-11-19-26(24)29(20-22-13-4-2-5-14-22)33(31,32)23-15-6-3-7-16-23/h2-19H,20H2,1H3,(H,28,30) |
| InChIKey | QIFCJUBXVDIILZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |