C29H28N2O5S — CID 17312901
2-[benzyl-(4-methylphenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)benzamide (PubChem CID 17312901) has the molecular formula C29H28N2O5S and a molecular weight of 516.62 g/mol. Its IUPAC name is 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)benzamide.
| Compound Name | 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 17312901 |
| Molecular Formula | C29H28N2O5S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccccc2N(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C29H28N2O5S/c1-21-13-16-24(17-14-21)37(33,34)31(20-22-9-5-4-6-10-22)27-12-8-7-11-25(27)29(32)30-26-19-23(35-2)15-18-28(26)36-3/h4-19H,20H2,1-3H3,(H,30,32) |
| InChIKey | WYTQUASLWRHLQF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |