C31H33N3O6S2 — CID 21372381
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(diethylsulfamoyl)phenyl]benzamide (PubChem CID 21372381) has the molecular formula C31H33N3O6S2 and a molecular weight of 607.75 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(diethylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(diethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 21372381 |
| Molecular Formula | C31H33N3O6S2 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[4-(diethylsulfamoyl)phenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)c2ccccc2N(Cc2ccccc2)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H33N3O6S2/c1-4-33(5-2)41(36,37)27-19-15-25(16-20-27)32-31(35)29-13-9-10-14-30(29)34(23-24-11-7-6-8-12-24)42(38,39)28-21-17-26(40-3)18-22-28/h6-22H,4-5,23H2,1-3H3,(H,32,35) |
| InChIKey | MBNYSWBZPDIQMG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |