C30H30N2O5S — CID 99940224
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(3-ethoxyphenyl)methyl]benzamide (PubChem CID 99940224) has the molecular formula C30H30N2O5S and a molecular weight of 530.65 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(3-ethoxyphenyl)methyl]benzamide.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(3-ethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 99940224 |
| Molecular Formula | C30H30N2O5S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(3-ethoxyphenyl)methyl]benzamide |
| SMILES | CCOc1cccc(CNC(=O)c2ccccc2N(Cc2ccccc2)S(=O)(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C30H30N2O5S/c1-3-37-26-13-9-12-24(20-26)21-31-30(33)28-14-7-8-15-29(28)32(22-23-10-5-4-6-11-23)38(34,35)27-18-16-25(36-2)17-19-27/h4-20H,3,21-22H2,1-2H3,(H,31,33) |
| InChIKey | DPMXQTLIMYWAAI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |