C21H18NO5S- — CID 6968685
2-[benzyl-(4-methoxyphenyl)sulfonylamino]benzoate (PubChem CID 6968685) has the molecular formula C21H18NO5S- and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]benzoate.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 6968685 |
| Molecular Formula | C21H18NO5S- |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]benzoate |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C21H19NO5S/c1-27-17-11-13-18(14-12-17)28(25,26)22(15-16-7-3-2-4-8-16)20-10-6-5-9-19(20)21(23)24/h2-14H,15H2,1H3,(H,23,24)/p-1 |
| InChIKey | OHMIHTVYDBCNFQ-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |