C33H36N2O5S — CID 46764222
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[1-(4-methoxyphenyl)-3-methylbutyl]benzamide (PubChem CID 46764222) has the molecular formula C33H36N2O5S and a molecular weight of 572.73 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[1-(4-methoxyphenyl)-3-methylbutyl]benzamide.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[1-(4-methoxyphenyl)-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 46764222 |
| Molecular Formula | C33H36N2O5S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[1-(4-methoxyphenyl)-3-methylbutyl]benzamide |
| SMILES | COc1ccc(C(CC(C)C)NC(=O)c2ccccc2N(Cc2ccccc2)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H36N2O5S/c1-24(2)22-31(26-14-16-27(39-3)17-15-26)34-33(36)30-12-8-9-13-32(30)35(23-25-10-6-5-7-11-25)41(37,38)29-20-18-28(40-4)19-21-29/h5-21,24,31H,22-23H2,1-4H3,(H,34,36) |
| InChIKey | GDOQXBYBQRSOMF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |