C32H34N2O4S — CID 99644735
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(1S)-3-methyl-1-phenylbutyl]benzamide (PubChem CID 99644735) has the molecular formula C32H34N2O4S and a molecular weight of 542.70 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(1S)-3-methyl-1-phenylbutyl]benzamide.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(1S)-3-methyl-1-phenylbutyl]benzamide |
|---|---|
| PubChem CID | 99644735 |
| Molecular Formula | C32H34N2O4S |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[(1S)-3-methyl-1-phenylbutyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2C(=O)N[C@@H](CC(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N2O4S/c1-24(2)22-30(26-14-8-5-9-15-26)33-32(35)29-16-10-11-17-31(29)34(23-25-12-6-4-7-13-25)39(36,37)28-20-18-27(38-3)19-21-28/h4-21,24,30H,22-23H2,1-3H3,(H,33,35)/t30-/m0/s1 |
| InChIKey | KWQVYOPWMBBPEX-PMERELPUSA-N |
| XLogP | 6.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |