C22H20BrNO5S — CID 57229628
methyl 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-bromobenzoate (PubChem CID 57229628) has the molecular formula C22H20BrNO5S and a molecular weight of 490.38 g/mol. Its IUPAC name is methyl 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-bromobenzoate.
| Compound Name | methyl 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-bromobenzoate |
|---|---|
| PubChem CID | 57229628 |
| Molecular Formula | C22H20BrNO5S |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | methyl 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-bromobenzoate |
| SMILES | COC(=O)c1cccc(Br)c1N(Cc1ccccc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H20BrNO5S/c1-28-17-11-13-18(14-12-17)30(26,27)24(15-16-7-4-3-5-8-16)21-19(22(25)29-2)9-6-10-20(21)23/h3-14H,15H2,1-2H3 |
| InChIKey | BXQDBZGHCXUUBT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |