C22H20ClNO5S — CID 21310919
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-4-chloro-3-methylbenzoic acid (PubChem CID 21310919) has the molecular formula C22H20ClNO5S and a molecular weight of 445.92 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-4-chloro-3-methylbenzoic acid.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-4-chloro-3-methylbenzoic acid |
|---|---|
| PubChem CID | 21310919 |
| Molecular Formula | C22H20ClNO5S |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-4-chloro-3-methylbenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)c2c(C(=O)O)ccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C22H20ClNO5S/c1-15-20(23)13-12-19(22(25)26)21(15)24(14-16-6-4-3-5-7-16)30(27,28)18-10-8-17(29-2)9-11-18/h3-13H,14H2,1-2H3,(H,25,26) |
| InChIKey | RFRWQTKSNXZBKT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |