C26H27NO8S — CID 21310900
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(4-carboxybutoxy)benzoic acid (PubChem CID 21310900) has the molecular formula C26H27NO8S and a molecular weight of 513.57 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(4-carboxybutoxy)benzoic acid.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(4-carboxybutoxy)benzoic acid |
|---|---|
| PubChem CID | 21310900 |
| Molecular Formula | C26H27NO8S |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(4-carboxybutoxy)benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)c2c(OCCCCC(=O)O)cccc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H27NO8S/c1-34-20-13-15-21(16-14-20)36(32,33)27(18-19-8-3-2-4-9-19)25-22(26(30)31)10-7-11-23(25)35-17-6-5-12-24(28)29/h2-4,7-11,13-16H,5-6,12,17-18H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | OCKLBWQHZABVOF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|