C24H25NO7S — CID 21310898
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(3-hydroxypropoxy)benzoic acid (PubChem CID 21310898) has the molecular formula C24H25NO7S and a molecular weight of 471.53 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(3-hydroxypropoxy)benzoic acid.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(3-hydroxypropoxy)benzoic acid |
|---|---|
| PubChem CID | 21310898 |
| Molecular Formula | C24H25NO7S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-(3-hydroxypropoxy)benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)c2c(OCCCO)cccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H25NO7S/c1-31-19-11-13-20(14-12-19)33(29,30)25(17-18-7-3-2-4-8-18)23-21(24(27)28)9-5-10-22(23)32-16-6-15-26/h2-5,7-14,26H,6,15-17H2,1H3,(H,27,28) |
| InChIKey | SESYKBGIKKZIDY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|