C21H18N2O6S — CID 21310948
3-formyl-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]benzoic acid (PubChem CID 21310948) has the molecular formula C21H18N2O6S and a molecular weight of 426.45 g/mol. Its IUPAC name is 3-formyl-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]benzoic acid.
| Compound Name | 3-formyl-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 21310948 |
| Molecular Formula | C21H18N2O6S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 3-formyl-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)c2c(C=O)cccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H18N2O6S/c1-29-17-7-9-18(10-8-17)30(27,28)23(13-15-4-3-11-22-12-15)20-16(14-24)5-2-6-19(20)21(25)26/h2-12,14H,13H2,1H3,(H,25,26) |
| InChIKey | RJHPUTUVZMJEPR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|