C24H22N4O6S — CID 10141426
N-hydroxy-8-methoxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]quinoline-3-carboxamide (PubChem CID 10141426) has the molecular formula C24H22N4O6S and a molecular weight of 494.53 g/mol. Its IUPAC name is N-hydroxy-8-methoxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]quinoline-3-carboxamide.
| Compound Name | N-hydroxy-8-methoxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 10141426 |
| Molecular Formula | C24H22N4O6S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | N-hydroxy-8-methoxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]quinoline-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)c2c(C(=O)NO)cnc3c(OC)cccc23)cc1 |
| InChI | InChI=1S/C24H22N4O6S/c1-33-17-8-10-18(11-9-17)35(31,32)28(15-16-5-4-12-25-13-16)23-19-6-3-7-21(34-2)22(19)26-14-20(23)24(29)27-30/h3-14,30H,15H2,1-2H3,(H,27,29) |
| InChIKey | ZORDGSDKVXISJV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|