C27H23N5O5S — CID 10186703
4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-1-phenylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 10186703) has the molecular formula C27H23N5O5S and a molecular weight of 529.58 g/mol. Its IUPAC name is 4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-1-phenylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-1-phenylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10186703 |
| Molecular Formula | C27H23N5O5S |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-1-phenylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)c2c(C(=O)NO)cnc3c2cnn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23N5O5S/c1-37-21-12-14-22(15-13-21)38(35,36)31(18-19-8-4-2-5-9-19)25-23-17-29-32(20-10-6-3-7-11-20)26(23)28-16-24(25)27(33)30-34/h2-17,34H,18H2,1H3,(H,30,33) |
| InChIKey | BSISAJSRWXUFCK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|