C23H24N6O5S — CID 10206977
N-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 10206977) has the molecular formula C23H24N6O5S and a molecular weight of 496.55 g/mol. Its IUPAC name is N-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10206977 |
| Molecular Formula | C23H24N6O5S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)c2c(C(=O)NO)cnc3c2cnn3C(C)C)cc1 |
| InChI | InChI=1S/C23H24N6O5S/c1-15(2)29-22-19(13-26-29)21(20(12-25-22)23(30)27-31)28(14-16-5-4-10-24-11-16)35(32,33)18-8-6-17(34-3)7-9-18/h4-13,15,31H,14H2,1-3H3,(H,27,30) |
| InChIKey | SHIWBNQCLHTHIC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|