C20H20N4O7S2 — CID 158695318
4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-2-methylsulfonylpyrimidine-5-carboxamide (PubChem CID 158695318) has the molecular formula C20H20N4O7S2 and a molecular weight of 492.54 g/mol. Its IUPAC name is 4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-2-methylsulfonylpyrimidine-5-carboxamide.
| Compound Name | 4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-2-methylsulfonylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 158695318 |
| Molecular Formula | C20H20N4O7S2 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-2-methylsulfonylpyrimidine-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)c2nc(S(C)(=O)=O)ncc2C(=O)NO)cc1 |
| InChI | InChI=1S/C20H20N4O7S2/c1-31-15-8-10-16(11-9-15)33(29,30)24(13-14-6-4-3-5-7-14)18-17(19(25)23-26)12-21-20(22-18)32(2,27)28/h3-12,26H,13H2,1-2H3,(H,23,25) |
| InChIKey | IGWCJIARCYTVNH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 155.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|