C25H26N2O7S — CID 142641471
tert-butyl 3-formyl-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethoxy)amino]benzoate (PubChem CID 142641471) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is tert-butyl 3-formyl-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethoxy)amino]benzoate.
| Compound Name | tert-butyl 3-formyl-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethoxy)amino]benzoate |
|---|---|
| PubChem CID | 142641471 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | tert-butyl 3-formyl-2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethoxy)amino]benzoate |
| SMILES | COc1ccc(S(=O)(=O)N(OCc2cccnc2)c2c(C=O)cccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H26N2O7S/c1-25(2,3)34-24(29)22-9-5-8-19(16-28)23(22)27(33-17-18-7-6-14-26-15-18)35(30,31)21-12-10-20(32-4)11-13-21/h5-16H,17H2,1-4H3 |
| InChIKey | XEEBIKOBPSFYAN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 112.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|