C22H20N2O5S — CID 139895004
2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-pyridin-3-ylethenyl]anilino]acetic acid (PubChem CID 139895004) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is 2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-pyridin-3-ylethenyl]anilino]acetic acid.
| Compound Name | 2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-pyridin-3-ylethenyl]anilino]acetic acid |
|---|---|
| PubChem CID | 139895004 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-pyridin-3-ylethenyl]anilino]acetic acid |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)O)c2ccccc2/C=C\c2cccnc2)cc1 |
| InChI | InChI=1S/C22H20N2O5S/c1-29-19-10-12-20(13-11-19)30(27,28)24(16-22(25)26)21-7-3-2-6-18(21)9-8-17-5-4-14-23-15-17/h2-15H,16H2,1H3,(H,25,26)/b9-8- |
| InChIKey | ZKVZGLOSQBQRDI-HJWRWDBZSA-N |
| XLogP | 3.54 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |