C22H20N2O4S — CID 167028467
N-(4-methoxyphenyl)sulfonyl-N-[2-[(Z)-2-pyridin-4-ylethenyl]phenyl]acetamide (PubChem CID 167028467) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-(4-methoxyphenyl)sulfonyl-N-[2-[(Z)-2-pyridin-4-ylethenyl]phenyl]acetamide.
| Compound Name | N-(4-methoxyphenyl)sulfonyl-N-[2-[(Z)-2-pyridin-4-ylethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 167028467 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-(4-methoxyphenyl)sulfonyl-N-[2-[(Z)-2-pyridin-4-ylethenyl]phenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C(C)=O)c2ccccc2/C=C\c2ccncc2)cc1 |
| InChI | InChI=1S/C22H20N2O4S/c1-17(25)24(29(26,27)21-11-9-20(28-2)10-12-21)22-6-4-3-5-19(22)8-7-18-13-15-23-16-14-18/h3-16H,1-2H3/b8-7- |
| InChIKey | XZWCYESVKLEKQO-FPLPWBNLSA-N |
| XLogP | 4.00 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |