C27H30N4O5S — CID 69341477
N-(4-methoxyphenyl)sulfonyl-2-(4-methylpiperazin-1-yl)-N-[2-[2-(1-oxidopyridin-1-ium-4-yl)ethenyl]phenyl]acetamide (PubChem CID 69341477) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is N-(4-methoxyphenyl)sulfonyl-2-(4-methylpiperazin-1-yl)-N-[2-[2-(1-oxidopyridin-1-ium-4-yl)ethenyl]phenyl]acetamide.
| Compound Name | N-(4-methoxyphenyl)sulfonyl-2-(4-methylpiperazin-1-yl)-N-[2-[2-(1-oxidopyridin-1-ium-4-yl)ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 69341477 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | N-(4-methoxyphenyl)sulfonyl-2-(4-methylpiperazin-1-yl)-N-[2-[2-(1-oxidopyridin-1-ium-4-yl)ethenyl]phenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C(=O)CN2CCN(C)CC2)c2ccccc2C=Cc2cc[n+]([O-])cc2)cc1 |
| InChI | InChI=1S/C27H30N4O5S/c1-28-17-19-29(20-18-28)21-27(32)31(37(34,35)25-11-9-24(36-2)10-12-25)26-6-4-3-5-23(26)8-7-22-13-15-30(33)16-14-22/h3-16H,17-21H2,1-2H3 |
| InChIKey | VNLVFEQMJOYJRR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 97.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|