C22H22N2O4S — CID 10272987
N-(2-hydroxyethyl)-4-methoxy-N-[2-[(E)-2-pyridin-4-ylethenyl]phenyl]benzenesulfonamide (PubChem CID 10272987) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-methoxy-N-[2-[(E)-2-pyridin-4-ylethenyl]phenyl]benzenesulfonamide.
| Compound Name | N-(2-hydroxyethyl)-4-methoxy-N-[2-[(E)-2-pyridin-4-ylethenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10272987 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-(2-hydroxyethyl)-4-methoxy-N-[2-[(E)-2-pyridin-4-ylethenyl]phenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCO)c2ccccc2/C=C/c2ccncc2)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c1-28-20-8-10-21(11-9-20)29(26,27)24(16-17-25)22-5-3-2-4-19(22)7-6-18-12-14-23-15-13-18/h2-15,25H,16-17H2,1H3/b7-6+ |
| InChIKey | JNPLUGXSSYAUQL-VOTSOKGWSA-N |
| XLogP | 3.45 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |