C22H20N2O6S — CID 139895022
2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-(1-oxidopyridin-1-ium-2-yl)ethenyl]anilino]acetic acid (PubChem CID 139895022) has the molecular formula C22H20N2O6S and a molecular weight of 440.48 g/mol. Its IUPAC name is 2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-(1-oxidopyridin-1-ium-2-yl)ethenyl]anilino]acetic acid.
| Compound Name | 2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-(1-oxidopyridin-1-ium-2-yl)ethenyl]anilino]acetic acid |
|---|---|
| PubChem CID | 139895022 |
| Molecular Formula | C22H20N2O6S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-[N-(4-methoxyphenyl)sulfonyl-2-[(Z)-2-(1-oxidopyridin-1-ium-2-yl)ethenyl]anilino]acetic acid |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)O)c2ccccc2/C=C\c2cccc[n+]2[O-])cc1 |
| InChI | InChI=1S/C22H20N2O6S/c1-30-19-11-13-20(14-12-19)31(28,29)24(16-22(25)26)21-8-3-2-6-17(21)9-10-18-7-4-5-15-23(18)27/h2-15H,16H2,1H3,(H,25,26)/b10-9- |
| InChIKey | GJFIILFOGCBVGB-KTKRTIGZSA-N |
| XLogP | 2.78 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|