C19H17NO6S — CID 174785200
2-[(1-hydroxynaphthalen-2-yl)-(4-methoxyphenyl)sulfonylamino]acetic acid (PubChem CID 174785200) has the molecular formula C19H17NO6S and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-[(1-hydroxynaphthalen-2-yl)-(4-methoxyphenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(1-hydroxynaphthalen-2-yl)-(4-methoxyphenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 174785200 |
| Molecular Formula | C19H17NO6S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-[(1-hydroxynaphthalen-2-yl)-(4-methoxyphenyl)sulfonylamino]acetic acid |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)O)c2ccc3ccccc3c2O)cc1 |
| InChI | InChI=1S/C19H17NO6S/c1-26-14-7-9-15(10-8-14)27(24,25)20(12-18(21)22)17-11-6-13-4-2-3-5-16(13)19(17)23/h2-11,23H,12H2,1H3,(H,21,22) |
| InChIKey | CWXZLWAWILTBOP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |